C28H35N9O3 — CID 135355837
5-tert-butyl-N-[2-(2-methoxyethyl)-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 135355837) has the molecular formula C28H35N9O3 and a molecular weight of 545.65 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-(2-methoxyethyl)-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[2-(2-methoxyethyl)-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 135355837 |
| Molecular Formula | C28H35N9O3 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 5-tert-butyl-N-[2-(2-methoxyethyl)-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | COCCN1CCC(NC(=O)c2noc(C(C)(C)C)n2)c2ccc(-c3ccnc(Nc4cnn(C)c4)n3)cc2C1 |
| InChI | InChI=1S/C28H35N9O3/c1-28(2,3)26-34-24(35-40-26)25(38)32-23-9-11-37(12-13-39-5)16-19-14-18(6-7-21(19)23)22-8-10-29-27(33-22)31-20-15-30-36(4)17-20/h6-8,10,14-15,17,23H,9,11-13,16H2,1-5H3,(H,32,38)(H,29,31,33) |
| InChIKey | NDKLSMJNYPRSEP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |