C25H29N9O2 — CID 135355859
5-tert-butyl-N-[8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 135355859) has the molecular formula C25H29N9O2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 5-tert-butyl-N-[8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 135355859 |
| Molecular Formula | C25H29N9O2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 5-tert-butyl-N-[8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-2,3,4,5-tetrahydro-1H-3-benzazepin-5-yl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | Cn1cc(Nc2nccc(-c3ccc4c(c3)CCNCC4NC(=O)c3noc(C(C)(C)C)n3)n2)cn1 |
| InChI | InChI=1S/C25H29N9O2/c1-25(2,3)23-32-21(33-36-23)22(35)30-20-13-26-9-7-15-11-16(5-6-18(15)20)19-8-10-27-24(31-19)29-17-12-28-34(4)14-17/h5-6,8,10-12,14,20,26H,7,9,13H2,1-4H3,(H,30,35)(H,27,29,31) |
| InChIKey | DEICZIXYTPURPR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 135.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |