C27H33N9O — CID 135355927
5-tert-butyl-4-methyl-N-[2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 135355927) has the molecular formula C27H33N9O and a molecular weight of 499.62 g/mol. Its IUPAC name is 5-tert-butyl-4-methyl-N-[2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-tert-butyl-4-methyl-N-[2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 135355927 |
| Molecular Formula | C27H33N9O |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 5-tert-butyl-4-methyl-N-[2-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1cc(Nc2nccc(-c3ccc4c(c3)CCCCC4NC(=O)c3nnc(C(C)(C)C)n3C)n2)cn1 |
| InChI | InChI=1S/C27H33N9O/c1-27(2,3)25-34-33-23(36(25)5)24(37)31-22-9-7-6-8-17-14-18(10-11-20(17)22)21-12-13-28-26(32-21)30-19-15-29-35(4)16-19/h10-16,22H,6-9H2,1-5H3,(H,31,37)(H,28,30,32) |
| InChIKey | DQLBEZLARAKITM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |