About potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate
potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 135355952) has the molecular formula C7H9KN2O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate.
Molecular Properties
| Compound Name | potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate |
| PubChem CID | 135355952 |
| Molecular Formula | C7H9KN2O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CC(C)(C)c1nnc(C(=O)[O-])o1.[K+] |
| InChI | InChI=1S/C7H10N2O3.K/c1-7(2,3)6-9-8-4(12-6)5(10)11;/h1-3H3,(H,10,11);/q;+1/p-1 |
| InChIKey | PEBNVISHTWMUMV-UHFFFAOYSA-M |
| XLogP | -3.27 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate (CID 135355952) is potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate is CC(C)(C)c1nnc(C(=O)[O-])o1.[K+].
What is the InChIKey of potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is PEBNVISHTWMUMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10N2O3.K/c1-7(2,3)6-9-8-4(12-6)5(10)11;/h1-3H3,(H,10,11);/q;+1/p-1.
What are the key properties of potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate?
potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 208.26 g/mol, XLogP of -3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-tert-butyl-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 135355952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).