C30H37N9O4 — CID 135356265
tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate (PubChem CID 135356265) has the molecular formula C30H37N9O4 and a molecular weight of 587.69 g/mol. Its IUPAC name is tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate.
| Compound Name | tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 135356265 |
| Molecular Formula | C30H37N9O4 |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
| SMILES | Cn1cc(Nc2nccc(-c3ccc4c(c3)CN(C(=O)OC(C)(C)C)CCC4NC(=O)c3noc(C(C)(C)C)n3)n2)cn1 |
| InChI | InChI=1S/C30H37N9O4/c1-29(2,3)26-36-24(37-43-26)25(40)34-23-11-13-39(28(41)42-30(4,5)6)16-19-14-18(8-9-21(19)23)22-10-12-31-27(35-22)33-20-15-32-38(7)17-20/h8-10,12,14-15,17,23H,11,13,16H2,1-7H3,(H,34,40)(H,31,33,35) |
| InChIKey | VXMJEXHIDWCWGZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |