C29H36N10O2 — CID 135356325
1-tert-butyl-N-[(5R)-8-[2-[(1,3-dimethylpyrazol-4-yl)amino]pyrimidin-4-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]triazole-4-carboxamide (PubChem CID 135356325) has the molecular formula C29H36N10O2 and a molecular weight of 556.68 g/mol. Its IUPAC name is 1-tert-butyl-N-[(5R)-8-[2-[(1,3-dimethylpyrazol-4-yl)amino]pyrimidin-4-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]triazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[(5R)-8-[2-[(1,3-dimethylpyrazol-4-yl)amino]pyrimidin-4-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 135356325 |
| Molecular Formula | C29H36N10O2 |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 1-tert-butyl-N-[(5R)-8-[2-[(1,3-dimethylpyrazol-4-yl)amino]pyrimidin-4-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]triazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1Nc1nccc(-c2ccc3c(c2)CN(C2COC2)CC[C@H]3NC(=O)c2cn(C(C)(C)C)nn2)n1 |
| InChI | InChI=1S/C29H36N10O2/c1-18-25(14-37(5)35-18)33-28-30-10-8-23(32-28)19-6-7-22-20(12-19)13-38(21-16-41-17-21)11-9-24(22)31-27(40)26-15-39(36-34-26)29(2,3)4/h6-8,10,12,14-15,21,24H,9,11,13,16-17H2,1-5H3,(H,31,40)(H,30,32,33)/t24-/m1/s1 |
| InChIKey | OEKCBUGDRLQPDI-XMMPIXPASA-N |
| XLogP | 3.35 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |