C31H39N9O4 — CID 135356525
tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-ethylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate (PubChem CID 135356525) has the molecular formula C31H39N9O4 and a molecular weight of 601.71 g/mol. Its IUPAC name is tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-ethylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate.
| Compound Name | tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-ethylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 135356525 |
| Molecular Formula | C31H39N9O4 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | tert-butyl 5-[(5-tert-butyl-1,2,4-oxadiazole-3-carbonyl)amino]-8-[2-[(1-ethylpyrazol-4-yl)amino]pyrimidin-4-yl]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
| SMILES | CCn1cc(Nc2nccc(-c3ccc4c(c3)CN(C(=O)OC(C)(C)C)CCC4NC(=O)c3noc(C(C)(C)C)n3)n2)cn1 |
| InChI | InChI=1S/C31H39N9O4/c1-8-40-18-21(16-33-40)34-28-32-13-11-23(36-28)19-9-10-22-20(15-19)17-39(29(42)43-31(5,6)7)14-12-24(22)35-26(41)25-37-27(44-38-25)30(2,3)4/h9-11,13,15-16,18,24H,8,12,14,17H2,1-7H3,(H,35,41)(H,32,34,36) |
| InChIKey | AGAAPNULJZNEID-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 153.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |