C23H19BrClNO5S — CID 135356817
[(2R,3R,5R,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-3-yl] methanesulfonate (PubChem CID 135356817) has the molecular formula C23H19BrClNO5S and a molecular weight of 536.83 g/mol. Its IUPAC name is [(2R,3R,5R,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,5R,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 135356817 |
| Molecular Formula | C23H19BrClNO5S |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | [(2R,3R,5R,6R)-6-(4-bromophenyl)-10-chloro-2-hydroxy-5-phenyl-7-oxa-12-azatricyclo[6.4.0.02,6]dodeca-1(8),9,11-trien-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@H](c2ccccc2)[C@]2(c3ccc(Br)cc3)Oc3cc(Cl)cnc3[C@@]12O |
| InChI | InChI=1S/C23H19BrClNO5S/c1-32(28,29)31-20-12-18(14-5-3-2-4-6-14)23(15-7-9-16(24)10-8-15)22(20,27)21-19(30-23)11-17(25)13-26-21/h2-11,13,18,20,27H,12H2,1H3/t18-,20-,22+,23+/m1/s1 |
| InChIKey | RHUBJXNGMYIVCZ-SQMBMXPBSA-N |
| XLogP | 4.51 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|