C27H27BrClF2N3O3 — CID 135357370
5-[(6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid (PubChem CID 135357370) has the molecular formula C27H27BrClF2N3O3 and a molecular weight of 594.88 g/mol. Its IUPAC name is 5-[(6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid.
| Compound Name | 5-[(6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 135357370 |
| Molecular Formula | C27H27BrClF2N3O3 |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | 5-[(6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chloro-3,6-difluorophenyl)pentanoic acid |
| SMILES | Cc1c(N2CCCCC2)nc2ccc(Br)cc2c1C(=O)NCC(CCC(=O)O)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C27H27BrClF2N3O3/c1-15-23(18-13-17(28)6-9-21(18)33-26(15)34-11-3-2-4-12-34)27(37)32-14-16(5-10-22(35)36)24-19(30)7-8-20(31)25(24)29/h6-9,13,16H,2-5,10-12,14H2,1H3,(H,32,37)(H,35,36) |
| InChIKey | VDHJPBNFGKNQMK-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|