C22H30ClFN4O3S — CID 135357661
[(2S)-1-[(2R,3R,4S)-3-fluoro-4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]azanium chloride (PubChem CID 135357661) has the molecular formula C22H30ClFN4O3S and a molecular weight of 485.03 g/mol. Its IUPAC name is [(2S)-1-[(2R,3R,4S)-3-fluoro-4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]azanium chloride.
| Compound Name | [(2S)-1-[(2R,3R,4S)-3-fluoro-4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 135357661 |
| Molecular Formula | C22H30ClFN4O3S |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [(2S)-1-[(2R,3R,4S)-3-fluoro-4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]azanium chloride |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2[C@@H](F)[C@@H](O)CN2C(=O)[C@@H]([NH3+])C(C)(C)C)cc1.[Cl-] |
| InChI | InChI=1S/C22H29FN4O3S.ClH/c1-12-18(31-11-26-12)14-7-5-13(6-8-14)9-25-20(29)17-16(23)15(28)10-27(17)21(30)19(24)22(2,3)4;/h5-8,11,15-17,19,28H,9-10,24H2,1-4H3,(H,25,29);1H/t15-,16-,17-,19+;/m0./s1 |
| InChIKey | XMXGKXGRFSXGMZ-JMCPPILBSA-N |
| XLogP | -1.69 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |