C27H23BrN2O3 — CID 135357796
4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-phenylbutanoic acid (PubChem CID 135357796) has the molecular formula C27H23BrN2O3 and a molecular weight of 503.40 g/mol. Its IUPAC name is 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-phenylbutanoic acid.
| Compound Name | 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 135357796 |
| Molecular Formula | C27H23BrN2O3 |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 4-[(6-bromo-3-methyl-2-phenylquinoline-4-carbonyl)amino]-3-phenylbutanoic acid |
| SMILES | Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)NCC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C27H23BrN2O3/c1-17-25(27(33)29-16-20(14-24(31)32)18-8-4-2-5-9-18)22-15-21(28)12-13-23(22)30-26(17)19-10-6-3-7-11-19/h2-13,15,20H,14,16H2,1H3,(H,29,33)(H,31,32) |
| InChIKey | ZNCOIXQUHNMNNS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |