C16H11NO5S2 — CID 1353580
[2-methoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 1353580) has the molecular formula C16H11NO5S2 and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1353580 |
| Molecular Formula | C16H11NO5S2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | [2-methoxy-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=C2\SC(=S)NC2=O)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C16H11NO5S2/c1-20-12-7-9(8-13-14(18)17-16(23)24-13)4-5-10(12)22-15(19)11-3-2-6-21-11/h2-8H,1H3,(H,17,18,23)/b13-8- |
| InChIKey | GEGVVFXOWNIEEO-JYRVWZFOSA-N |
| XLogP | 3.00 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|