About methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate
methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate (PubChem CID 135358812) has the molecular formula C16H11Cl2N3O3
and a molecular weight of 364.19 g/mol. Its IUPAC name is methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate |
| PubChem CID | 135358812 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1ccc(Cl)c(Cl)c1Oc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C16H11Cl2N3O3/c1-23-16(22)13(20-21-19)9-10-7-8-12(17)14(18)15(10)24-11-5-3-2-4-6-11/h2-9H,1H3/b13-9+ |
| InChIKey | XCSVUACQSHBPIR-UKTHLTGXSA-N |
| XLogP | 5.61 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate?
The IUPAC name of methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate (CID 135358812) is methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate.
What is the SMILES notation for methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate?
The canonical SMILES for methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate is COC(=O)/C(=C\c1ccc(Cl)c(Cl)c1Oc1ccccc1)N=[N+]=[N-].
What is the InChIKey of methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate?
The InChIKey is XCSVUACQSHBPIR-UKTHLTGXSA-N. The full InChI is InChI=1S/C16H11Cl2N3O3/c1-23-16(22)13(20-21-19)9-10-7-8-12(17)14(18)15(10)24-11-5-3-2-4-6-11/h2-9H,1H3/b13-9+.
What are the key properties of methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate?
methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate has a molecular weight of 364.19 g/mol, XLogP of 5.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-azido-3-(3,4-dichloro-2-phenoxyphenyl)prop-2-enoate is sourced from PubChem (CID 135358812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).