About (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene
(E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene (PubChem CID 135359007) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene.
Molecular Properties
| Compound Name | (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene |
| PubChem CID | 135359007 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene |
| SMILES | COC(/C=C/CCOCC/C=C/C(OC)OC)OC |
| InChI | InChI=1S/C14H26O5/c1-15-13(16-2)9-5-7-11-19-12-8-6-10-14(17-3)18-4/h5-6,9-10,13-14H,7-8,11-12H2,1-4H3/b9-5+,10-6+ |
| InChIKey | HQWHSQHHRMZYEX-NXZHAISVSA-N |
| XLogP | 2.13 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene?
The IUPAC name of (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene (CID 135359007) is (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene.
What is the SMILES notation for (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene?
The canonical SMILES for (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene is COC(/C=C/CCOCC/C=C/C(OC)OC)OC.
What is the InChIKey of (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene?
The InChIKey is HQWHSQHHRMZYEX-NXZHAISVSA-N. The full InChI is InChI=1S/C14H26O5/c1-15-13(16-2)9-5-7-11-19-12-8-6-10-14(17-3)18-4/h5-6,9-10,13-14H,7-8,11-12H2,1-4H3/b9-5+,10-6+.
What are the key properties of (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene?
(E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene has a molecular weight of 274.36 g/mol, XLogP of 2.13, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-[(E)-5,5-dimethoxypent-3-enoxy]-1,1-dimethoxypent-2-ene is sourced from PubChem (CID 135359007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).