About [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate
[(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate (PubChem CID 135359095) has the molecular formula C11H22O5S
and a molecular weight of 266.36 g/mol. Its IUPAC name is [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate |
| PubChem CID | 135359095 |
| Molecular Formula | C11H22O5S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate |
| SMILES | CCOC(/C=C\CC(C)OS(C)(=O)=O)OCC |
| InChI | InChI=1S/C11H22O5S/c1-5-14-11(15-6-2)9-7-8-10(3)16-17(4,12)13/h7,9-11H,5-6,8H2,1-4H3/b9-7- |
| InChIKey | NFEDCWYZRGXXFJ-CLFYSBASSA-N |
| XLogP | 1.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate?
The IUPAC name of [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate (CID 135359095) is [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate.
What is the SMILES notation for [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate?
The canonical SMILES for [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate is CCOC(/C=C\CC(C)OS(C)(=O)=O)OCC.
What is the InChIKey of [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate?
The InChIKey is NFEDCWYZRGXXFJ-CLFYSBASSA-N. The full InChI is InChI=1S/C11H22O5S/c1-5-14-11(15-6-2)9-7-8-10(3)16-17(4,12)13/h7,9-11H,5-6,8H2,1-4H3/b9-7-.
What are the key properties of [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate?
[(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate has a molecular weight of 266.36 g/mol, XLogP of 1.70, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-6,6-diethoxyhex-4-en-2-yl] methanesulfonate is sourced from PubChem (CID 135359095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).