C24H35NO6 — CID 135359204
1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;2-hydroperoxy-2,4,4-trimethylpentane (PubChem CID 135359204) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;2-hydroperoxy-2,4,4-trimethylpentane.
| Compound Name | 1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;2-hydroperoxy-2,4,4-trimethylpentane |
|---|---|
| PubChem CID | 135359204 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;2-hydroperoxy-2,4,4-trimethylpentane |
| SMILES | CC(C)(C)CC(C)(C)OO.Oc1ccc(CC2NCCc3cc(O)c(O)cc32)cc1O |
| InChI | InChI=1S/C16H17NO4.C8H18O2/c18-13-2-1-9(6-14(13)19)5-12-11-8-16(21)15(20)7-10(11)3-4-17-12;1-7(2,3)6-8(4,5)10-9/h1-2,6-8,12,17-21H,3-5H2;9H,6H2,1-5H3 |
| InChIKey | NVXLSNHWHVRISP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|