C23H29ClO6S — CID 135360405
(3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[[5-(2-propoxyethyl)thiophen-2-yl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360405) has the molecular formula C23H29ClO6S and a molecular weight of 469.00 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[[5-(2-propoxyethyl)thiophen-2-yl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[[5-(2-propoxyethyl)thiophen-2-yl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360405 |
| Molecular Formula | C23H29ClO6S |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[[5-(2-propoxyethyl)thiophen-2-yl]methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | CCCOCCc1ccc(Cc2cc3c(cc2Cl)CO[C@]32O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C23H29ClO6S/c1-3-7-28-8-6-16-4-5-17(31-16)9-14-10-18-15(11-19(14)24)12-29-23(18)22(27)21(26)20(25)13(2)30-23/h4-5,10-11,13,20-22,25-27H,3,6-9,12H2,1-2H3/t13-,20-,21+,22-,23+/m1/s1 |
| InChIKey | BJLRFXBDKXVNOU-HMXWYGJXSA-N |
| XLogP | 3.15 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|