C22H26O5 — CID 135360458
(3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360458) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360458 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | CCc1ccc(Cc2ccc3c(c2)[C@]2(OC3)O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H26O5/c1-3-14-4-6-15(7-5-14)10-16-8-9-17-12-26-22(18(17)11-16)21(25)20(24)19(23)13(2)27-22/h4-9,11,13,19-21,23-25H,3,10,12H2,1-2H3/t13-,19-,20+,21-,22+/m1/s1 |
| InChIKey | TYKNXFPQGLILIT-YKQWKKEUSA-N |
| XLogP | 2.02 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |