C18H18Cl2O5S — CID 135360478
(3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-chlorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360478) has the molecular formula C18H18Cl2O5S and a molecular weight of 417.31 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-chlorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-chlorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360478 |
| Molecular Formula | C18H18Cl2O5S |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-chlorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | C[C@H]1O[C@]2(OCc3cc(Cl)c(Cc4ccc(Cl)s4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18Cl2O5S/c1-8-15(21)16(22)17(23)18(25-8)12-5-9(4-11-2-3-14(20)26-11)13(19)6-10(12)7-24-18/h2-3,5-6,8,15-17,21-23H,4,7H2,1H3/t8-,15-,16+,17-,18+/m1/s1 |
| InChIKey | OANFNBCSQAJHPK-RZSKSGGJSA-N |
| XLogP | 2.83 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |