C23H22FNO5S — CID 135360651
(3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360651) has the molecular formula C23H22FNO5S and a molecular weight of 443.50 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360651 |
| Molecular Formula | C23H22FNO5S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-fluoro-6'-methyl-5-[(5-pyridin-2-ylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | C[C@H]1O[C@]2(OCc3cc(F)c(Cc4ccc(-c5ccccn5)s4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H22FNO5S/c1-12-20(26)21(27)22(28)23(30-12)16-9-13(17(24)10-14(16)11-29-23)8-15-5-6-19(31-15)18-4-2-3-7-25-18/h2-7,9-10,12,20-22,26-28H,8,11H2,1H3/t12-,20-,21+,22-,23+/m1/s1 |
| InChIKey | XWLLBFIRWKXQPV-YMEHLMFXSA-N |
| XLogP | 2.72 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |