C24H24O5 — CID 135360652
(3S,3'R,4'S,5'S,6'R)-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360652) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360652 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | C[C@H]1O[C@]2(OCc3ccc(Cc4ccc5ccccc5c4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H24O5/c1-14-21(25)22(26)23(27)24(29-14)20-12-16(7-9-19(20)13-28-24)10-15-6-8-17-4-2-3-5-18(17)11-15/h2-9,11-12,14,21-23,25-27H,10,13H2,1H3/t14-,21-,22+,23-,24+/m1/s1 |
| InChIKey | TYAPJAQCFJGTNX-RAEJBKIPSA-N |
| XLogP | 2.62 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |