C19H21ClO5S — CID 135360764
(3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360764) has the molecular formula C19H21ClO5S and a molecular weight of 396.89 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360764 |
| Molecular Formula | C19H21ClO5S |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-[(5-methylthiophen-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | Cc1ccc(Cc2cc3c(cc2Cl)CO[C@]32O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C19H21ClO5S/c1-9-3-4-13(26-9)5-11-6-14-12(7-15(11)20)8-24-19(14)18(23)17(22)16(21)10(2)25-19/h3-4,6-7,10,16-18,21-23H,5,8H2,1-2H3/t10-,16-,17+,18-,19+/m1/s1 |
| InChIKey | DVSLMYWENSQQCL-WBPUTQLOSA-N |
| XLogP | 2.49 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |