C20H17F24O4P — CID 135360799
diethyl [(Z)-3,3,4,4,5,5,6,6,7,7,8,11,11,12,12,13,13,14,14,15,15,16,16,16-tetracosafluorohexadec-8-enyl] phosphate (PubChem CID 135360799) has the molecular formula C20H17F24O4P and a molecular weight of 808.28 g/mol. Its IUPAC name is diethyl [(Z)-3,3,4,4,5,5,6,6,7,7,8,11,11,12,12,13,13,14,14,15,15,16,16,16-tetracosafluorohexadec-8-enyl] phosphate.
| Compound Name | diethyl [(Z)-3,3,4,4,5,5,6,6,7,7,8,11,11,12,12,13,13,14,14,15,15,16,16,16-tetracosafluorohexadec-8-enyl] phosphate |
|---|---|
| PubChem CID | 135360799 |
| Molecular Formula | C20H17F24O4P |
| Molecular Weight | 808.28 g/mol |
| Exact Mass | 808.05 |
| IUPAC Name | diethyl [(Z)-3,3,4,4,5,5,6,6,7,7,8,11,11,12,12,13,13,14,14,15,15,16,16,16-tetracosafluorohexadec-8-enyl] phosphate |
| SMILES | CCOP(=O)(OCC)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)/C(F)=C/CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H17F24O4P/c1-3-46-49(45,47-4-2)48-8-7-11(24,25)14(30,31)16(34,35)15(32,33)12(26,27)9(21)5-6-10(22,23)13(28,29)17(36,37)18(38,39)19(40,41)20(42,43)44/h5H,3-4,6-8H2,1-2H3/b9-5- |
| InChIKey | GDQPQDGQDDVYCP-UITAMQMPSA-N |
| XLogP | 10.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.28 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|