C8H8F3N7S — CID 135360834
[[5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]thiourea (PubChem CID 135360834) has the molecular formula C8H8F3N7S and a molecular weight of 291.26 g/mol. Its IUPAC name is [[5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]thiourea.
| Compound Name | [[5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]thiourea |
|---|---|
| PubChem CID | 135360834 |
| Molecular Formula | C8H8F3N7S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | [[5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]amino]thiourea |
| SMILES | Cc1cc(NNC(N)=S)n2nc(C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C8H8F3N7S/c1-3-2-4(15-16-6(12)19)18-7(13-3)14-5(17-18)8(9,10)11/h2,15H,1H3,(H3,12,16,19) |
| InChIKey | NKFUNWMGDCTBBU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|