About (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid
(4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 135361412) has the molecular formula C13H16BrNO4
and a molecular weight of 330.18 g/mol. Its IUPAC name is (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| PubChem CID | 135361412 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | CC1(C)OC[C@@H](COc2ccc(Br)cc2)N1C(=O)O |
| InChI | InChI=1S/C13H16BrNO4/c1-13(2)15(12(16)17)10(8-19-13)7-18-11-5-3-9(14)4-6-11/h3-6,10H,7-8H2,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | YRZABQXPGCPTGA-SNVBAGLBSA-N |
| XLogP | 2.94 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The IUPAC name of (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (CID 135361412) is (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
What is the SMILES notation for (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The canonical SMILES for (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid is CC1(C)OC[C@@H](COc2ccc(Br)cc2)N1C(=O)O.
What is the InChIKey of (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The InChIKey is YRZABQXPGCPTGA-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H16BrNO4/c1-13(2)15(12(16)17)10(8-19-13)7-18-11-5-3-9(14)4-6-11/h3-6,10H,7-8H2,1-2H3,(H,16,17)/t10-/m1/s1.
What are the key properties of (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
(4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid has a molecular weight of 330.18 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[(4-bromophenoxy)methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid is sourced from PubChem (CID 135361412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).