C19H24N6O — CID 135361531
1-[3-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 135361531) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[3-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135361531 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[3-[[5-(4-propan-2-ylanilino)-1,2,4-triazin-3-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2nncc(Nc3ccc(C(C)C)cc3)n2)C1 |
| InChI | InChI=1S/C19H24N6O/c1-4-18(26)25-10-9-16(12-25)22-19-23-17(11-20-24-19)21-15-7-5-14(6-8-15)13(2)3/h4-8,11,13,16H,1,9-10,12H2,2-3H3,(H2,21,22,23,24) |
| InChIKey | DUSIBQNYJABHEB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|