C27H25FN8O2 — CID 135363173
[2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]-morpholin-4-ylmethanone (PubChem CID 135363173) has the molecular formula C27H25FN8O2 and a molecular weight of 512.55 g/mol. Its IUPAC name is [2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 135363173 |
| Molecular Formula | C27H25FN8O2 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | [2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnn2c(N[C@@H]3CCc4[nH]c5ccccc5c4C3)nc(-c3cncc(F)c3)nc12)N1CCOCC1 |
| InChI | InChI=1S/C27H25FN8O2/c28-17-11-16(13-29-14-17)24-33-25-21(26(37)35-7-9-38-10-8-35)15-30-36(25)27(34-24)31-18-5-6-23-20(12-18)19-3-1-2-4-22(19)32-23/h1-4,11,13-15,18,32H,5-10,12H2,(H,31,33,34)/t18-/m1/s1 |
| InChIKey | WLSWWHFZPHBJFZ-GOSISDBHSA-N |
| XLogP | 3.25 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|