About ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate
ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate (PubChem CID 135364894) has the molecular formula C11H11F2NO3
and a molecular weight of 243.21 g/mol. Its IUPAC name is ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate.
Molecular Properties
| Compound Name | ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate |
| PubChem CID | 135364894 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate |
| SMILES | CCOC(=O)/C(Cc1ccc(F)cc1F)=N\O |
| InChI | InChI=1S/C11H11F2NO3/c1-2-17-11(15)10(14-16)5-7-3-4-8(12)6-9(7)13/h3-4,6,16H,2,5H2,1H3/b14-10- |
| InChIKey | LHJZDXYENHLBOG-UVTDQMKNSA-N |
| XLogP | 1.90 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate?
The IUPAC name of ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate (CID 135364894) is ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate.
What is the SMILES notation for ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate?
The canonical SMILES for ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate is CCOC(=O)/C(Cc1ccc(F)cc1F)=N\O.
What is the InChIKey of ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate?
The InChIKey is LHJZDXYENHLBOG-UVTDQMKNSA-N. The full InChI is InChI=1S/C11H11F2NO3/c1-2-17-11(15)10(14-16)5-7-3-4-8(12)6-9(7)13/h3-4,6,16H,2,5H2,1H3/b14-10-.
What are the key properties of ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate?
ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate has a molecular weight of 243.21 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-3-(2,4-difluorophenyl)-2-hydroxyiminopropanoate is sourced from PubChem (CID 135364894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).