C25H22N6O5S — CID 135364941
1-[1-formyl-4-([1,2,4]triazolo[4,3-a]pyridin-6-yloxy)-4H-naphthalen-1-yl]-3-[3-(methanesulfonamido)phenyl]urea (PubChem CID 135364941) has the molecular formula C25H22N6O5S and a molecular weight of 518.56 g/mol. Its IUPAC name is 1-[1-formyl-4-([1,2,4]triazolo[4,3-a]pyridin-6-yloxy)-4H-naphthalen-1-yl]-3-[3-(methanesulfonamido)phenyl]urea.
| Compound Name | 1-[1-formyl-4-([1,2,4]triazolo[4,3-a]pyridin-6-yloxy)-4H-naphthalen-1-yl]-3-[3-(methanesulfonamido)phenyl]urea |
|---|---|
| PubChem CID | 135364941 |
| Molecular Formula | C25H22N6O5S |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 1-[1-formyl-4-([1,2,4]triazolo[4,3-a]pyridin-6-yloxy)-4H-naphthalen-1-yl]-3-[3-(methanesulfonamido)phenyl]urea |
| SMILES | CS(=O)(=O)Nc1cccc(NC(=O)NC2(C=O)C=CC(Oc3ccc4nncn4c3)c3ccccc32)c1 |
| InChI | InChI=1S/C25H22N6O5S/c1-37(34,35)30-18-6-4-5-17(13-18)27-24(33)28-25(15-32)12-11-22(20-7-2-3-8-21(20)25)36-19-9-10-23-29-26-16-31(23)14-19/h2-16,22,30H,1H3,(H2,27,28,33) |
| InChIKey | OOKYEGFZSGMWLP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|