C21H30FN4O4P — CID 135365195
(3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)-4-fluorophenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid (PubChem CID 135365195) has the molecular formula C21H30FN4O4P and a molecular weight of 452.47 g/mol. Its IUPAC name is (3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)-4-fluorophenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid.
| Compound Name | (3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)-4-fluorophenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
|---|---|
| PubChem CID | 135365195 |
| Molecular Formula | C21H30FN4O4P |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (3S)-3-(4-aminobutyl)-1-[[2-(2,3-dimethylimidazol-4-yl)-4-fluorophenyl]methyl]-4-hydroxy-4-oxo-1,4λ5-azaphosphinane-3-carboxylic acid |
| SMILES | Cc1ncc(-c2cc(F)ccc2CN2CCP(=O)(O)[C@](CCCCN)(C(=O)O)C2)n1C |
| InChI | InChI=1S/C21H30FN4O4P/c1-15-24-12-19(25(15)2)18-11-17(22)6-5-16(18)13-26-9-10-31(29,30)21(14-26,20(27)28)7-3-4-8-23/h5-6,11-12H,3-4,7-10,13-14,23H2,1-2H3,(H,27,28)(H,29,30)/t21-/m0/s1 |
| InChIKey | MUKBNFMKTKDYIO-NRFANRHFSA-N |
| XLogP | 2.57 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|