C26H20N4O4 — CID 135365276
6-amino-4-(2,5-dimethoxyphenyl)-3-(1-formylnaphthalen-2-yl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 135365276) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 6-amino-4-(2,5-dimethoxyphenyl)-3-(1-formylnaphthalen-2-yl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(2,5-dimethoxyphenyl)-3-(1-formylnaphthalen-2-yl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 135365276 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 6-amino-4-(2,5-dimethoxyphenyl)-3-(1-formylnaphthalen-2-yl)-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | COc1ccc(OC)c(C2C(C#N)=C(N)Oc3n[nH]c(-c4ccc5ccccc5c4C=O)c32)c1 |
| InChI | InChI=1S/C26H20N4O4/c1-32-15-8-10-21(33-2)18(11-15)22-19(12-27)25(28)34-26-23(22)24(29-30-26)17-9-7-14-5-3-4-6-16(14)20(17)13-31/h3-11,13,22H,28H2,1-2H3,(H,29,30) |
| InChIKey | RFSOKXHAOSMSEX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 123.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|