C8H3F14NO2 — CID 135365570
2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropan-1-ol (PubChem CID 135365570) has the molecular formula C8H3F14NO2 and a molecular weight of 411.09 g/mol. Its IUPAC name is 2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropan-1-ol.
| Compound Name | 2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 135365570 |
| Molecular Formula | C8H3F14NO2 |
| Molecular Weight | 411.09 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropan-1-ol |
| SMILES | OCC(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H3F14NO2/c9-2(1-24,3(10,11)12)4(13,14)23-5(15,16)7(19,20)25-8(21,22)6(23,17)18/h24H,1H2 |
| InChIKey | FJIRHWSJUYBLLX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|