About 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one
8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one (PubChem CID 135365946) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one.
Molecular Properties
| Compound Name | 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one |
| PubChem CID | 135365946 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one |
| SMILES | CC1CC(=O)C2C3C=CC4(CCCC4CC12)O3 |
| InChI | InChI=1S/C15H20O2/c1-9-7-12(16)14-11(9)8-10-3-2-5-15(10)6-4-13(14)17-15/h4,6,9-11,13-14H,2-3,5,7-8H2,1H3 |
| InChIKey | LOVMACOZHQGONA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one?
The IUPAC name of 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one (CID 135365946) is 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one.
What is the SMILES notation for 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one?
The canonical SMILES for 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one is CC1CC(=O)C2C3C=CC4(CCCC4CC12)O3.
What is the InChIKey of 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one?
The InChIKey is LOVMACOZHQGONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-9-7-12(16)14-11(9)8-10-3-2-5-15(10)6-4-13(14)17-15/h4,6,9-11,13-14H,2-3,5,7-8H2,1H3.
What are the key properties of 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one?
8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one has a molecular weight of 232.32 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadec-13-en-10-one is sourced from PubChem (CID 135365946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).