C23H26FN3O5 — CID 135366080
8-tert-butyl-3-fluoro-13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid (PubChem CID 135366080) has the molecular formula C23H26FN3O5 and a molecular weight of 443.48 g/mol. Its IUPAC name is 8-tert-butyl-3-fluoro-13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid.
| Compound Name | 8-tert-butyl-3-fluoro-13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 135366080 |
| Molecular Formula | C23H26FN3O5 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 8-tert-butyl-3-fluoro-13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),2,5,11,13,15-hexaene-5-carboxylic acid |
| SMILES | COCCCOc1cccc2c3n(nc12)CC(C(C)(C)C)n1cc(C(=O)O)c(=O)c(F)c1-3 |
| InChI | InChI=1S/C23H26FN3O5/c1-23(2,3)16-12-27-19(20-17(24)21(28)14(22(29)30)11-26(16)20)13-7-5-8-15(18(13)25-27)32-10-6-9-31-4/h5,7-8,11,16H,6,9-10,12H2,1-4H3,(H,29,30) |
| InChIKey | NBFCXVDSYGMLLV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|