C24H24INO2 — CID 135366817
(3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(3-iodophenyl)propanoic acid (PubChem CID 135366817) has the molecular formula C24H24INO2 and a molecular weight of 485.37 g/mol. Its IUPAC name is (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(3-iodophenyl)propanoic acid.
| Compound Name | (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(3-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 135366817 |
| Molecular Formula | C24H24INO2 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | (3S)-3-[benzyl-[(1R)-1-phenylethyl]amino]-3-(3-iodophenyl)propanoic acid |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](CC(=O)O)c1cccc(I)c1 |
| InChI | InChI=1S/C24H24INO2/c1-18(20-11-6-3-7-12-20)26(17-19-9-4-2-5-10-19)23(16-24(27)28)21-13-8-14-22(25)15-21/h2-15,18,23H,16-17H2,1H3,(H,27,28)/t18-,23+/m1/s1 |
| InChIKey | LCQMCXXPFZJMSQ-JPYJTQIMSA-N |
| XLogP | 6.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|