(3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid

C17H19NO4 — CID 135366920

IUPAC(3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid
SMILESCOc1cccc(OC)c1-c1cccc([C@@H](N)CC(=O)O)c1
InChIInChI=1S/C17H19NO4/c1-21-14-7-4-8-15(22-2)17(14)12-6-3-5-11(9-12)13(18)10-16(19)20/h3-9,13H,10,18H2,1-2H3,(H,19,20)/t13-/m0/s1
InChIKeyBHESIBUCIZHEKM-ZDUSSCGKSA-N
MW301.34 g/mol
LogP2.85
Rot. Bonds6

About (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid

(3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid (PubChem CID 135366920) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid.

Molecular Properties

Compound Name(3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid
PubChem CID135366920
Molecular FormulaC17H19NO4
Molecular Weight301.34 g/mol
Exact Mass301.13
IUPAC Name(3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid
SMILESCOc1cccc(OC)c1-c1cccc([C@@H](N)CC(=O)O)c1
InChIInChI=1S/C17H19NO4/c1-21-14-7-4-8-15(22-2)17(14)12-6-3-5-11(9-12)13(18)10-16(19)20/h3-9,13H,10,18H2,1-2H3,(H,19,20)/t13-/m0/s1
InChIKeyBHESIBUCIZHEKM-ZDUSSCGKSA-N
XLogP2.85
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.34
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid?
The IUPAC name of (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid (CID 135366920) is (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid.
What is the SMILES notation for (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid?
The canonical SMILES for (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid is COc1cccc(OC)c1-c1cccc([C@@H](N)CC(=O)O)c1.
What is the InChIKey of (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid?
The InChIKey is BHESIBUCIZHEKM-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H19NO4/c1-21-14-7-4-8-15(22-2)17(14)12-6-3-5-11(9-12)13(18)10-16(19)20/h3-9,13H,10,18H2,1-2H3,(H,19,20)/t13-/m0/s1.
What are the key properties of (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid?
(3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid has a molecular weight of 301.34 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-3-[3-(2,6-dimethoxyphenyl)phenyl]propanoic acid is sourced from PubChem (CID 135366920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).