C13H13F9N2O5S — CID 135367222
[5-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2-pyridinyl]-trimethylazanium;trifluoromethanesulfonate (PubChem CID 135367222) has the molecular formula C13H13F9N2O5S and a molecular weight of 480.31 g/mol. Its IUPAC name is [5-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2-pyridinyl]-trimethylazanium;trifluoromethanesulfonate.
| Compound Name | [5-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2-pyridinyl]-trimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135367222 |
| Molecular Formula | C13H13F9N2O5S |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | [5-(1,1,1,3,3,3-hexafluoropropan-2-yloxycarbonyl)-2-pyridinyl]-trimethylazanium;trifluoromethanesulfonate |
| SMILES | C[N+](C)(C)c1ccc(C(=O)OC(C(F)(F)F)C(F)(F)F)cn1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H13F6N2O2.CHF3O3S/c1-20(2,3)8-5-4-7(6-19-8)9(21)22-10(11(13,14)15)12(16,17)18;2-1(3,4)8(5,6)7/h4-6,10H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | XMAUIKATPOKRIW-UHFFFAOYSA-M |
| XLogP | 2.98 |
| TPSA | 96.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|