C20H36O2 — CID 135367664
3,7-dimethylocta-1,6-dien-3-ol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 135367664) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-ol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-ol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 135367664 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-ol;1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=CC(C)(O)CCC=C(C)C.CC1(C)C2CCC1(C)C(O)C2 |
| InChI | InChI=1S/2C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7;1-5-10(4,11)8-6-7-9(2)3/h7-8,11H,4-6H2,1-3H3;5,7,11H,1,6,8H2,2-4H3 |
| InChIKey | ULJVZWGNFFKYCG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|