C13H14FN3 — CID 135367858
3-(2-fluorophenyl)-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine (PubChem CID 135367858) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine.
| Compound Name | 3-(2-fluorophenyl)-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine |
|---|---|
| PubChem CID | 135367858 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-(2-fluorophenyl)-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepine |
| SMILES | Fc1ccccc1-c1n[nH]c2c1CCNCC2 |
| InChI | InChI=1S/C13H14FN3/c14-11-4-2-1-3-9(11)13-10-5-7-15-8-6-12(10)16-17-13/h1-4,15H,5-8H2,(H,16,17) |
| InChIKey | QAURIZRGIXYMSS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |