About N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine
N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 135368321) has the molecular formula C16H17N5
and a molecular weight of 279.35 g/mol. Its IUPAC name is N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine |
| PubChem CID | 135368321 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CCN(CC)c1nc(-c2ccncc2)nc2cnccc12 |
| InChI | InChI=1S/C16H17N5/c1-3-21(4-2)16-13-7-10-18-11-14(13)19-15(20-16)12-5-8-17-9-6-12/h5-11H,3-4H2,1-2H3 |
| InChIKey | PGOCRNZIASOKRK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine?
The IUPAC name of N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine (CID 135368321) is N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine?
The canonical SMILES for N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine is CCN(CC)c1nc(-c2ccncc2)nc2cnccc12.
What is the InChIKey of N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine?
The InChIKey is PGOCRNZIASOKRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5/c1-3-21(4-2)16-13-7-10-18-11-14(13)19-15(20-16)12-5-8-17-9-6-12/h5-11H,3-4H2,1-2H3.
What are the key properties of N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine?
N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine has a molecular weight of 279.35 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-pyridin-4-ylpyrido[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 135368321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).