About 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide
4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide (PubChem CID 135368519) has the molecular formula C16H15FN2O2
and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide |
| PubChem CID | 135368519 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2CCc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C16H15FN2O2/c17-14-6-5-12-7-8-19(15(12)9-14)10-11-1-3-13(4-2-11)16(20)18-21/h1-6,9,21H,7-8,10H2,(H,18,20) |
| InChIKey | ZQUOSIOGVTWRBG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide (CID 135368519) is 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide is O=C(NO)c1ccc(CN2CCc3ccc(F)cc32)cc1.
What is the InChIKey of 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide?
The InChIKey is ZQUOSIOGVTWRBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O2/c17-14-6-5-12-7-8-19(15(12)9-14)10-11-1-3-13(4-2-11)16(20)18-21/h1-6,9,21H,7-8,10H2,(H,18,20).
What are the key properties of 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide?
4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide has a molecular weight of 286.31 g/mol, XLogP of 2.51, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-fluoro-2,3-dihydroindol-1-yl)methyl]-N-hydroxybenzamide is sourced from PubChem (CID 135368519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).