About 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine
4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine (PubChem CID 135368546) has the molecular formula C19H21N5
and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine.
Molecular Properties
| Compound Name | 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine |
| PubChem CID | 135368546 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine |
| SMILES | CC1(C)CN(c2cc(-c3ccncc3)nc3cnccc23)CCN1 |
| InChI | InChI=1S/C19H21N5/c1-19(2)13-24(10-9-22-19)18-11-16(14-3-6-20-7-4-14)23-17-12-21-8-5-15(17)18/h3-8,11-12,22H,9-10,13H2,1-2H3 |
| InChIKey | DAAOLLLUQQMXHY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine?
The IUPAC name of 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine (CID 135368546) is 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine.
What is the SMILES notation for 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine?
The canonical SMILES for 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine is CC1(C)CN(c2cc(-c3ccncc3)nc3cnccc23)CCN1.
What is the InChIKey of 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine?
The InChIKey is DAAOLLLUQQMXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5/c1-19(2)13-24(10-9-22-19)18-11-16(14-3-6-20-7-4-14)23-17-12-21-8-5-15(17)18/h3-8,11-12,22H,9-10,13H2,1-2H3.
What are the key properties of 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine?
4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine has a molecular weight of 319.41 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethylpiperazin-1-yl)-2-pyridin-4-yl-1,7-naphthyridine is sourced from PubChem (CID 135368546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).