About 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol
6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 135368615) has the molecular formula C20H22INO5
and a molecular weight of 483.30 g/mol. Its IUPAC name is 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol |
| PubChem CID | 135368615 |
| Molecular Formula | C20H22INO5 |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1ccc(C(c2cc3c(cc2O)OCO3)N2CCCC2I)c(OC)c1 |
| InChI | InChI=1S/C20H22INO5/c1-24-12-5-6-13(16(8-12)25-2)20(22-7-3-4-19(22)21)14-9-17-18(10-15(14)23)27-11-26-17/h5-6,8-10,19-20,23H,3-4,7,11H2,1-2H3 |
| InChIKey | NIHSPSAEFIUEBV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol?
The IUPAC name of 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol (CID 135368615) is 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol.
What is the SMILES notation for 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol?
The canonical SMILES for 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol is COc1ccc(C(c2cc3c(cc2O)OCO3)N2CCCC2I)c(OC)c1.
What is the InChIKey of 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol?
The InChIKey is NIHSPSAEFIUEBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22INO5/c1-24-12-5-6-13(16(8-12)25-2)20(22-7-3-4-19(22)21)14-9-17-18(10-15(14)23)27-11-26-17/h5-6,8-10,19-20,23H,3-4,7,11H2,1-2H3.
What are the key properties of 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol?
6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol has a molecular weight of 483.30 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,4-dimethoxyphenyl)-(2-iodopyrrolidin-1-yl)methyl]-1,3-benzodioxol-5-ol is sourced from PubChem (CID 135368615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).