About 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one
3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one (PubChem CID 135368956) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one |
| PubChem CID | 135368956 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one |
| SMILES | O=c1onc(CC2CCCCC2)n1CC1CCCCC1 |
| InChI | InChI=1S/C16H26N2O2/c19-16-18(12-14-9-5-2-6-10-14)15(17-20-16)11-13-7-3-1-4-8-13/h13-14H,1-12H2 |
| InChIKey | YYBBNAHINKHOKA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one?
The IUPAC name of 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one (CID 135368956) is 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one is O=c1onc(CC2CCCCC2)n1CC1CCCCC1.
What is the InChIKey of 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one?
The InChIKey is YYBBNAHINKHOKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2/c19-16-18(12-14-9-5-2-6-10-14)15(17-20-16)11-13-7-3-1-4-8-13/h13-14H,1-12H2.
What are the key properties of 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one?
3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one has a molecular weight of 278.40 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(cyclohexylmethyl)-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 135368956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).