About hexadecanoate;hydron
hexadecanoate;hydron (PubChem CID 135369651) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is hexadecanoate;hydron.
Molecular Properties
| Compound Name | hexadecanoate;hydron |
| PubChem CID | 135369651 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | hexadecanoate;hydron |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].[H+] |
| InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18) |
| InChIKey | IPCSVZSSVZVIGE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecanoate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecanoate;hydron?
The IUPAC name of hexadecanoate;hydron (CID 135369651) is hexadecanoate;hydron.
What is the SMILES notation for hexadecanoate;hydron?
The canonical SMILES for hexadecanoate;hydron is CCCCCCCCCCCCCCCC(=O)[O-].[H+].
What is the InChIKey of hexadecanoate;hydron?
The InChIKey is IPCSVZSSVZVIGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18).
What are the key properties of hexadecanoate;hydron?
hexadecanoate;hydron has a molecular weight of 256.43 g/mol, XLogP of 4.33, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecanoate;hydron is sourced from PubChem (CID 135369651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).