C9H15F6N2O4S+ — CID 135370149
2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide;trimethyl(oxiran-2-ylmethyl)azanium (PubChem CID 135370149) has the molecular formula C9H15F6N2O4S+ and a molecular weight of 361.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide;trimethyl(oxiran-2-ylmethyl)azanium.
| Compound Name | 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide;trimethyl(oxiran-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 135370149 |
| Molecular Formula | C9H15F6N2O4S+ |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide;trimethyl(oxiran-2-ylmethyl)azanium |
| SMILES | C[N+](C)(C)CC1CO1.O=C(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H14NO.C3HF6NO3S/c1-7(2,3)4-6-5-8-6;4-2(5,6)1(11)10-14(12,13)3(7,8)9/h6H,4-5H2,1-3H3;(H,10,11)/q+1; |
| InChIKey | MUKBEWXPHOHEBS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|