C29H44FN5O6 — CID 135370401
(2S,4R)-N-[(2S)-1-[[(2S)-4-benzamido-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-fluoro-1-hexanoyl-N-methylpyrrolidine-2-carboxamide (PubChem CID 135370401) has the molecular formula C29H44FN5O6 and a molecular weight of 577.70 g/mol. Its IUPAC name is (2S,4R)-N-[(2S)-1-[[(2S)-4-benzamido-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-fluoro-1-hexanoyl-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(2S)-1-[[(2S)-4-benzamido-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-fluoro-1-hexanoyl-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135370401 |
| Molecular Formula | C29H44FN5O6 |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | (2S,4R)-N-[(2S)-1-[[(2S)-4-benzamido-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]-4-fluoro-1-hexanoyl-N-methylpyrrolidine-2-carboxamide |
| SMILES | CCCCCC(=O)N1C[C@H](F)C[C@H]1C(=O)N(C)[C@H](C(=O)N[C@@H](CCNC(=O)c1ccccc1)C(=O)NO)C(C)CC |
| InChI | InChI=1S/C29H44FN5O6/c1-5-7-9-14-24(36)35-18-21(30)17-23(35)29(40)34(4)25(19(3)6-2)28(39)32-22(27(38)33-41)15-16-31-26(37)20-12-10-8-11-13-20/h8,10-13,19,21-23,25,41H,5-7,9,14-18H2,1-4H3,(H,31,37)(H,32,39)(H,33,38)/t19?,21-,22+,23+,25+/m1/s1 |
| InChIKey | KKMGMVINNFYZQX-LIOLAMKISA-N |
| XLogP | 2.19 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|