C21H22F3N9O2 — CID 135370596
(9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide (PubChem CID 135370596) has the molecular formula C21H22F3N9O2 and a molecular weight of 489.46 g/mol. Its IUPAC name is (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide.
| Compound Name | (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 135370596 |
| Molecular Formula | C21H22F3N9O2 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (9S)-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-5-N-(1,1,1-trifluoropropan-2-yl)-1,4,6,8-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-5,8-dicarboxamide |
| SMILES | Cc1ccc2c(NC(=O)N3c4nc(C(=O)NC(C)C(F)(F)F)ncc4N4CCC[C@H]3C4)n[nH]c2n1 |
| InChI | InChI=1S/C21H22F3N9O2/c1-10-5-6-13-15(26-10)30-31-16(13)29-20(35)33-12-4-3-7-32(9-12)14-8-25-17(28-18(14)33)19(34)27-11(2)21(22,23)24/h5-6,8,11-12H,3-4,7,9H2,1-2H3,(H,27,34)(H2,26,29,30,31,35)/t11?,12-/m0/s1 |
| InChIKey | ZKRYPIIRKKCDLO-KIYNQFGBSA-N |
| XLogP | 2.76 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |