C13H16F3N5O — CID 135370659
(9S)-3-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carboxamide (PubChem CID 135370659) has the molecular formula C13H16F3N5O and a molecular weight of 315.30 g/mol. Its IUPAC name is (9S)-3-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carboxamide.
| Compound Name | (9S)-3-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 135370659 |
| Molecular Formula | C13H16F3N5O |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (9S)-3-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-5-carboxamide |
| SMILES | Cc1nc(C(=O)N[C@H](C)C(F)(F)F)nc2c1N1CC[C@@H](C1)N2 |
| InChI | InChI=1S/C13H16F3N5O/c1-6-9-10(19-8-3-4-21(9)5-8)20-11(17-6)12(22)18-7(2)13(14,15)16/h7-8H,3-5H2,1-2H3,(H,18,22)(H,17,19,20)/t7-,8+/m1/s1 |
| InChIKey | DVBCCLURQCGOEC-SFYZADRCSA-N |
| XLogP | 1.47 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |