C24H24F3N7O4 — CID 135370662
(9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-5-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide (PubChem CID 135370662) has the molecular formula C24H24F3N7O4 and a molecular weight of 531.50 g/mol. Its IUPAC name is (9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-5-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide.
| Compound Name | (9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-5-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
|---|---|
| PubChem CID | 135370662 |
| Molecular Formula | C24H24F3N7O4 |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (9S)-N-[2-(2,3-dihydroxypropoxy)pyrimidin-5-yl]-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-8-carboxamide |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)nc2c1N1CC[C@@H](C1)N2C(=O)Nc1cnc(OCC(O)CO)nc1 |
| InChI | InChI=1S/C24H24F3N7O4/c1-13-19-21(32-20(30-13)14-3-2-4-15(7-14)24(25,26)27)34(17-5-6-33(19)10-17)23(37)31-16-8-28-22(29-9-16)38-12-18(36)11-35/h2-4,7-9,17-18,35-36H,5-6,10-12H2,1H3,(H,31,37)/t17-,18?/m0/s1 |
| InChIKey | OJGGVHDTZPZLKF-ZENAZSQFSA-N |
| XLogP | 2.62 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |